C18H25NOS2 — CID 8513527
2-(1-adamantylsulfanyl)-N-[(1S)-1-thiophen-2-ylethyl]acetamide (PubChem CID 8513527) has the molecular formula C18H25NOS2 and a molecular weight of 335.54 g/mol. Its IUPAC name is 2-(1-adamantylsulfanyl)-N-[(1S)-1-thiophen-2-ylethyl]acetamide.
| Compound Name | 2-(1-adamantylsulfanyl)-N-[(1S)-1-thiophen-2-ylethyl]acetamide |
|---|---|
| PubChem CID | 8513527 |
| Molecular Formula | C18H25NOS2 |
| Molecular Weight | 335.54 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 2-(1-adamantylsulfanyl)-N-[(1S)-1-thiophen-2-ylethyl]acetamide |
| SMILES | C[C@H](NC(=O)CSC12CC3CC(CC(C3)C1)C2)c1cccs1 |
| InChI | InChI=1S/C18H25NOS2/c1-12(16-3-2-4-21-16)19-17(20)11-22-18-8-13-5-14(9-18)7-15(6-13)10-18/h2-4,12-15H,5-11H2,1H3,(H,19,20)/t12-,13?,14?,15?,18?/m0/s1 |
| InChIKey | NXBQJCBBRARJFV-IHWZXDPASA-N |
| XLogP | 4.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |