C24H22N4O5 — CID 85154174
methyl 3-[[2-(1-benzoyl-4-ethenyl-2,3-dihydroindol-3-yl)acetyl]-methylamino]-2-diazo-3-oxopropanoate (PubChem CID 85154174) has the molecular formula C24H22N4O5 and a molecular weight of 446.46 g/mol. Its IUPAC name is methyl 3-[[2-(1-benzoyl-4-ethenyl-2,3-dihydroindol-3-yl)acetyl]-methylamino]-2-diazo-3-oxopropanoate.
| Compound Name | methyl 3-[[2-(1-benzoyl-4-ethenyl-2,3-dihydroindol-3-yl)acetyl]-methylamino]-2-diazo-3-oxopropanoate |
|---|---|
| PubChem CID | 85154174 |
| Molecular Formula | C24H22N4O5 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | methyl 3-[[2-(1-benzoyl-4-ethenyl-2,3-dihydroindol-3-yl)acetyl]-methylamino]-2-diazo-3-oxopropanoate |
| SMILES | C=Cc1cccc2c1C(CC(=O)N(C)C(=O)C(=[N+]=[N-])C(=O)OC)CN2C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H22N4O5/c1-4-15-11-8-12-18-20(15)17(14-28(18)22(30)16-9-6-5-7-10-16)13-19(29)27(2)23(31)21(26-25)24(32)33-3/h4-12,17H,1,13-14H2,2-3H3 |
| InChIKey | ZLVWHIJBXJLPJW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 120.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|