C29H26N2O4S — CID 85154728
3-[4-[1-butyl-5-[4-(2-carboxyethenyl)phenyl]-2-thiophen-2-ylimidazol-4-yl]phenyl]prop-2-enoic acid (PubChem CID 85154728) has the molecular formula C29H26N2O4S and a molecular weight of 498.60 g/mol. Its IUPAC name is 3-[4-[1-butyl-5-[4-(2-carboxyethenyl)phenyl]-2-thiophen-2-ylimidazol-4-yl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[1-butyl-5-[4-(2-carboxyethenyl)phenyl]-2-thiophen-2-ylimidazol-4-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 85154728 |
| Molecular Formula | C29H26N2O4S |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | 3-[4-[1-butyl-5-[4-(2-carboxyethenyl)phenyl]-2-thiophen-2-ylimidazol-4-yl]phenyl]prop-2-enoic acid |
| SMILES | CCCCn1c(-c2cccs2)nc(-c2ccc(C=CC(=O)O)cc2)c1-c1ccc(C=CC(=O)O)cc1 |
| InChI | InChI=1S/C29H26N2O4S/c1-2-3-18-31-28(23-14-8-21(9-15-23)11-17-26(34)35)27(30-29(31)24-5-4-19-36-24)22-12-6-20(7-13-22)10-16-25(32)33/h4-17,19H,2-3,18H2,1H3,(H,32,33)(H,34,35) |
| InChIKey | XZWNJMALDJBOOG-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|