C24H48OSi — CID 85171021
tert-butyl-dimethyl-(5-methylheptadeca-1,16-dien-7-yloxy)silane (PubChem CID 85171021) has the molecular formula C24H48OSi and a molecular weight of 380.73 g/mol. Its IUPAC name is tert-butyl-dimethyl-(5-methylheptadeca-1,16-dien-7-yloxy)silane.
| Compound Name | tert-butyl-dimethyl-(5-methylheptadeca-1,16-dien-7-yloxy)silane |
|---|---|
| PubChem CID | 85171021 |
| Molecular Formula | C24H48OSi |
| Molecular Weight | 380.73 g/mol |
| Exact Mass | 380.35 |
| IUPAC Name | tert-butyl-dimethyl-(5-methylheptadeca-1,16-dien-7-yloxy)silane |
| SMILES | C=CCCCCCCCCC(CC(C)CCC=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H48OSi/c1-9-11-13-14-15-16-17-18-20-23(21-22(3)19-12-10-2)25-26(7,8)24(4,5)6/h9-10,22-23H,1-2,11-21H2,3-8H3 |
| InChIKey | MCRUVWSVDJBELJ-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.73 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|