C15H16N2O2 — CID 85177494
2-but-3-enyl-5-diazo-1-phenylpentane-1,4-dione (PubChem CID 85177494) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is 2-but-3-enyl-5-diazo-1-phenylpentane-1,4-dione.
| Compound Name | 2-but-3-enyl-5-diazo-1-phenylpentane-1,4-dione |
|---|---|
| PubChem CID | 85177494 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-but-3-enyl-5-diazo-1-phenylpentane-1,4-dione |
| SMILES | C=CCCC(CC(=O)C=[N+]=[N-])C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H16N2O2/c1-2-3-7-13(10-14(18)11-17-16)15(19)12-8-5-4-6-9-12/h2,4-6,8-9,11,13H,1,3,7,10H2 |
| InChIKey | PXPVYMPNMPTQPM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|