C9H16O4 — CID 85185675
3,6-dimethoxy-5-methyloxane-2-carbaldehyde (PubChem CID 85185675) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is 3,6-dimethoxy-5-methyloxane-2-carbaldehyde.
| Compound Name | 3,6-dimethoxy-5-methyloxane-2-carbaldehyde |
|---|---|
| PubChem CID | 85185675 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 3,6-dimethoxy-5-methyloxane-2-carbaldehyde |
| SMILES | COC1CC(C)C(OC)OC1C=O |
| InChI | InChI=1S/C9H16O4/c1-6-4-7(11-2)8(5-10)13-9(6)12-3/h5-9H,4H2,1-3H3 |
| InChIKey | DIFNZCABFQPISA-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|