C16H30O9 — CID 85207667
2-(hydroxymethyl)-6-(3,7,8-trihydroxy-2-methyl-6-methylideneoctan-2-yl)oxyoxane-3,4,5-triol (PubChem CID 85207667) has the molecular formula C16H30O9 and a molecular weight of 366.41 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-(3,7,8-trihydroxy-2-methyl-6-methylideneoctan-2-yl)oxyoxane-3,4,5-triol.
| Compound Name | 2-(hydroxymethyl)-6-(3,7,8-trihydroxy-2-methyl-6-methylideneoctan-2-yl)oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 85207667 |
| Molecular Formula | C16H30O9 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 2-(hydroxymethyl)-6-(3,7,8-trihydroxy-2-methyl-6-methylideneoctan-2-yl)oxyoxane-3,4,5-triol |
| SMILES | C=C(CCC(O)C(C)(C)OC1OC(CO)C(O)C(O)C1O)C(O)CO |
| InChI | InChI=1S/C16H30O9/c1-8(9(19)6-17)4-5-11(20)16(2,3)25-15-14(23)13(22)12(21)10(7-18)24-15/h9-15,17-23H,1,4-7H2,2-3H3 |
| InChIKey | XHACZRKXNRWLKD-UHFFFAOYSA-N |
| XLogP | -2.37 |
| TPSA | 160.07 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|