C17H22F3O5P — CID 85208293
5-dimethoxyphosphoryl-2-ethoxy-6-methyl-4-[2-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyran (PubChem CID 85208293) has the molecular formula C17H22F3O5P and a molecular weight of 394.33 g/mol. Its IUPAC name is 5-dimethoxyphosphoryl-2-ethoxy-6-methyl-4-[2-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyran.
| Compound Name | 5-dimethoxyphosphoryl-2-ethoxy-6-methyl-4-[2-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 85208293 |
| Molecular Formula | C17H22F3O5P |
| Molecular Weight | 394.33 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 5-dimethoxyphosphoryl-2-ethoxy-6-methyl-4-[2-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyran |
| SMILES | CCOC1CC(c2ccccc2C(F)(F)F)C(P(=O)(OC)OC)=C(C)O1 |
| InChI | InChI=1S/C17H22F3O5P/c1-5-24-15-10-13(12-8-6-7-9-14(12)17(18,19)20)16(11(2)25-15)26(21,22-3)23-4/h6-9,13,15H,5,10H2,1-4H3 |
| InChIKey | YGEDMWUAPKMLMG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.33 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|