C46H30F12N2O6P2 — CID 85212404
3-[[3-[bis(2-oxocyclohepta[b]furan-3-yl)methyl]phenyl]-(1-methyl-2-oxocyclohepta[b]pyrrol-3-yl)methyl]-1-methylcyclohepta[b]pyrrol-2-one dihexafluorophosphate (PubChem CID 85212404) has the molecular formula C46H30F12N2O6P2 and a molecular weight of 996.68 g/mol. Its IUPAC name is 3-[[3-[bis(2-oxocyclohepta[b]furan-3-yl)methyl]phenyl]-(1-methyl-2-oxocyclohepta[b]pyrrol-3-yl)methyl]-1-methylcyclohepta[b]pyrrol-2-one dihexafluorophosphate.
| Compound Name | 3-[[3-[bis(2-oxocyclohepta[b]furan-3-yl)methyl]phenyl]-(1-methyl-2-oxocyclohepta[b]pyrrol-3-yl)methyl]-1-methylcyclohepta[b]pyrrol-2-one dihexafluorophosphate |
|---|---|
| PubChem CID | 85212404 |
| Molecular Formula | C46H30F12N2O6P2 |
| Molecular Weight | 996.68 g/mol |
| Exact Mass | 996.14 |
| IUPAC Name | 3-[[3-[bis(2-oxocyclohepta[b]furan-3-yl)methyl]phenyl]-(1-methyl-2-oxocyclohepta[b]pyrrol-3-yl)methyl]-1-methylcyclohepta[b]pyrrol-2-one dihexafluorophosphate |
| SMILES | Cn1c2cccccc-2c([C+](c2cccc([C+](c3c4cccccc-4oc3=O)c3c4cccccc-4oc3=O)c2)c2c3cccccc-3n(C)c2=O)c1=O.F[P-](F)(F)(F)(F)F.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C46H30N2O6.2F6P/c1-47-33-22-11-3-7-18-29(33)39(43(47)49)37(40-30-19-8-4-12-23-34(30)48(2)44(40)50)27-16-15-17-28(26-27)38(41-31-20-9-5-13-24-35(31)53-45(41)51)42-32-21-10-6-14-25-36(32)54-46(42)52;2*1-7(2,3,4,5)6/h3-26H,1-2H3;;/q+2;2*-1 |
| InChIKey | VHSKCJFFZLFATO-UHFFFAOYSA-N |
| XLogP | 14.21 |
| TPSA | 104.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 996.68 |
| LogP ≤ 5 | 14.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|