C16H19ClO3 — CID 85232101
methyl 3-[2-(4-chlorophenyl)ethyl]-5-methyl-2-oxocyclopentane-1-carboxylate (PubChem CID 85232101) has the molecular formula C16H19ClO3 and a molecular weight of 294.78 g/mol. Its IUPAC name is methyl 3-[2-(4-chlorophenyl)ethyl]-5-methyl-2-oxocyclopentane-1-carboxylate.
| Compound Name | methyl 3-[2-(4-chlorophenyl)ethyl]-5-methyl-2-oxocyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 85232101 |
| Molecular Formula | C16H19ClO3 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | methyl 3-[2-(4-chlorophenyl)ethyl]-5-methyl-2-oxocyclopentane-1-carboxylate |
| SMILES | COC(=O)C1C(=O)C(CCc2ccc(Cl)cc2)CC1C |
| InChI | InChI=1S/C16H19ClO3/c1-10-9-12(15(18)14(10)16(19)20-2)6-3-11-4-7-13(17)8-5-11/h4-5,7-8,10,12,14H,3,6,9H2,1-2H3 |
| InChIKey | YYFCFOGTKFPOPV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|