C22H19NO4 — CID 8525138
[(2R)-1-(1H-indol-3-yl)-1-oxopropan-2-yl] 2-(6-methyl-1-benzofuran-3-yl)acetate (PubChem CID 8525138) has the molecular formula C22H19NO4 and a molecular weight of 361.40 g/mol. Its IUPAC name is [(2R)-1-(1H-indol-3-yl)-1-oxopropan-2-yl] 2-(6-methyl-1-benzofuran-3-yl)acetate.
| Compound Name | [(2R)-1-(1H-indol-3-yl)-1-oxopropan-2-yl] 2-(6-methyl-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 8525138 |
| Molecular Formula | C22H19NO4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | [(2R)-1-(1H-indol-3-yl)-1-oxopropan-2-yl] 2-(6-methyl-1-benzofuran-3-yl)acetate |
| SMILES | Cc1ccc2c(CC(=O)O[C@H](C)C(=O)c3c[nH]c4ccccc34)coc2c1 |
| InChI | InChI=1S/C22H19NO4/c1-13-7-8-16-15(12-26-20(16)9-13)10-21(24)27-14(2)22(25)18-11-23-19-6-4-3-5-17(18)19/h3-9,11-12,14,23H,10H2,1-2H3/t14-/m1/s1 |
| InChIKey | WJIUHUNCGWSLRP-CQSZACIVSA-N |
| XLogP | 4.58 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |