C28H32OSi — CID 85275903
4-(3-methylcyclopentyl)-1-triphenylsilylbutan-1-one (PubChem CID 85275903) has the molecular formula C28H32OSi and a molecular weight of 412.65 g/mol. Its IUPAC name is 4-(3-methylcyclopentyl)-1-triphenylsilylbutan-1-one.
| Compound Name | 4-(3-methylcyclopentyl)-1-triphenylsilylbutan-1-one |
|---|---|
| PubChem CID | 85275903 |
| Molecular Formula | C28H32OSi |
| Molecular Weight | 412.65 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 4-(3-methylcyclopentyl)-1-triphenylsilylbutan-1-one |
| SMILES | CC1CCC(CCCC(=O)[Si](c2ccccc2)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C28H32OSi/c1-23-20-21-24(22-23)12-11-19-28(29)30(25-13-5-2-6-14-25,26-15-7-3-8-16-26)27-17-9-4-10-18-27/h2-10,13-18,23-24H,11-12,19-22H2,1H3 |
| InChIKey | IEIOHZMIYXHZSM-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.65 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|