C21H26O2 — CID 85281787
4,8-dimethyl-10-(2-methylprop-1-enyl)bicyclo[9.3.1]pentadeca-1(14),3,7,11-tetraene-13,15-dione (PubChem CID 85281787) has the molecular formula C21H26O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 4,8-dimethyl-10-(2-methylprop-1-enyl)bicyclo[9.3.1]pentadeca-1(14),3,7,11-tetraene-13,15-dione.
| Compound Name | 4,8-dimethyl-10-(2-methylprop-1-enyl)bicyclo[9.3.1]pentadeca-1(14),3,7,11-tetraene-13,15-dione |
|---|---|
| PubChem CID | 85281787 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 4,8-dimethyl-10-(2-methylprop-1-enyl)bicyclo[9.3.1]pentadeca-1(14),3,7,11-tetraene-13,15-dione |
| SMILES | CC(C)=CC1CC(C)=CCCC(C)=CCC2=CC(=O)C=C1C2=O |
| InChI | InChI=1S/C21H26O2/c1-14(2)10-18-11-16(4)7-5-6-15(3)8-9-17-12-19(22)13-20(18)21(17)23/h7-8,10,12-13,18H,5-6,9,11H2,1-4H3 |
| InChIKey | VCFIMWBIRXENPS-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|