C13H21NO3 — CID 85291110
3-[2-(2,2-dimethylpropyl)pent-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 85291110) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 3-[2-(2,2-dimethylpropyl)pent-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[2-(2,2-dimethylpropyl)pent-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 85291110 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 3-[2-(2,2-dimethylpropyl)pent-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C=CCC(CC(C)(C)C)C(=O)N1CCOC1=O |
| InChI | InChI=1S/C13H21NO3/c1-5-6-10(9-13(2,3)4)11(15)14-7-8-17-12(14)16/h5,10H,1,6-9H2,2-4H3 |
| InChIKey | QKIAUEOYBINBOK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|