About 3-thiophen-2-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole
3-thiophen-2-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole (PubChem CID 853036) has the molecular formula C10H10N2S
and a molecular weight of 190.27 g/mol. Its IUPAC name is 3-thiophen-2-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole.
Analyze 3-thiophen-2-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-thiophen-2-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The IUPAC name of 3-thiophen-2-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole (CID 853036) is 3-thiophen-2-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole.
What is the SMILES notation for 3-thiophen-2-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The canonical SMILES for 3-thiophen-2-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole is c1csc(-c2cnc3n2CCC3)c1.
What is the InChIKey of 3-thiophen-2-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The InChIKey is LYZIBEKPTIUDDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2S/c1-4-10-11-7-8(12(10)5-1)9-3-2-6-13-9/h2-3,6-7H,1,4-5H2.
What are the key properties of 3-thiophen-2-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
3-thiophen-2-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole has a molecular weight of 190.27 g/mol, XLogP of 2.56, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-thiophen-2-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole is sourced from PubChem (CID 853036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).