C13H11ClFN3O3S — CID 8534701
[2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 4-ethylthiadiazole-5-carboxylate (PubChem CID 8534701) has the molecular formula C13H11ClFN3O3S and a molecular weight of 343.77 g/mol. Its IUPAC name is [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 4-ethylthiadiazole-5-carboxylate.
| Compound Name | [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 4-ethylthiadiazole-5-carboxylate |
|---|---|
| PubChem CID | 8534701 |
| Molecular Formula | C13H11ClFN3O3S |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 4-ethylthiadiazole-5-carboxylate |
| SMILES | CCc1nnsc1C(=O)OCC(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H11ClFN3O3S/c1-2-10-12(22-18-17-10)13(20)21-6-11(19)16-7-3-4-9(15)8(14)5-7/h3-5H,2,6H2,1H3,(H,16,19) |
| InChIKey | KAIYGPURTAYQFJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |