C15H15N3O4S — CID 8535449
[2-(4-acetamidophenyl)-2-oxoethyl] 4-ethylthiadiazole-5-carboxylate (PubChem CID 8535449) has the molecular formula C15H15N3O4S and a molecular weight of 333.37 g/mol. Its IUPAC name is [2-(4-acetamidophenyl)-2-oxoethyl] 4-ethylthiadiazole-5-carboxylate.
| Compound Name | [2-(4-acetamidophenyl)-2-oxoethyl] 4-ethylthiadiazole-5-carboxylate |
|---|---|
| PubChem CID | 8535449 |
| Molecular Formula | C15H15N3O4S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | [2-(4-acetamidophenyl)-2-oxoethyl] 4-ethylthiadiazole-5-carboxylate |
| SMILES | CCc1nnsc1C(=O)OCC(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C15H15N3O4S/c1-3-12-14(23-18-17-12)15(21)22-8-13(20)10-4-6-11(7-5-10)16-9(2)19/h4-7H,3,8H2,1-2H3,(H,16,19) |
| InChIKey | GXFGHQICNAYMKL-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |