C18H21N3O4S — CID 8535773
[2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 4-ethylthiadiazole-5-carboxylate (PubChem CID 8535773) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is [2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 4-ethylthiadiazole-5-carboxylate.
| Compound Name | [2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 4-ethylthiadiazole-5-carboxylate |
|---|---|
| PubChem CID | 8535773 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | [2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 4-ethylthiadiazole-5-carboxylate |
| SMILES | CCc1nnsc1C(=O)OCC(=O)NC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H21N3O4S/c1-5-13-15(26-21-20-13)17(24)25-10-14(22)19-16(23)11-6-8-12(9-7-11)18(2,3)4/h6-9H,5,10H2,1-4H3,(H,19,22,23) |
| InChIKey | KSZQBLOFSWFYJQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |