About (4-ethoxyphenyl)thiourea
(4-ethoxyphenyl)thiourea (PubChem CID 853569) has the molecular formula C9H12N2OS
and a molecular weight of 196.28 g/mol. Its IUPAC name is (4-ethoxyphenyl)thiourea.
Molecular Properties
| Compound Name | (4-ethoxyphenyl)thiourea |
| PubChem CID | 853569 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.28 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (4-ethoxyphenyl)thiourea |
| SMILES | CCOc1ccc(NC(N)=S)cc1 |
| InChI | InChI=1S/C9H12N2OS/c1-2-12-8-5-3-7(4-6-8)11-9(10)13/h3-6H,2H2,1H3,(H3,10,11,13) |
| InChIKey | QGLYTNIXHPCRCF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4-ethoxyphenyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethoxyphenyl)thiourea?
The IUPAC name of (4-ethoxyphenyl)thiourea (CID 853569) is (4-ethoxyphenyl)thiourea.
What is the SMILES notation for (4-ethoxyphenyl)thiourea?
The canonical SMILES for (4-ethoxyphenyl)thiourea is CCOc1ccc(NC(N)=S)cc1.
What is the InChIKey of (4-ethoxyphenyl)thiourea?
The InChIKey is QGLYTNIXHPCRCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2OS/c1-2-12-8-5-3-7(4-6-8)11-9(10)13/h3-6H,2H2,1H3,(H3,10,11,13).
What are the key properties of (4-ethoxyphenyl)thiourea?
(4-ethoxyphenyl)thiourea has a molecular weight of 196.28 g/mol, XLogP of 1.74, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethoxyphenyl)thiourea is sourced from PubChem (CID 853569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).