C12H12O2 — CID 85376016
9-methyl-12-oxatricyclo[7.2.1.01,7]dodec-10-en-4-yn-6-one (PubChem CID 85376016) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is 9-methyl-12-oxatricyclo[7.2.1.01,7]dodec-10-en-4-yn-6-one.
| Compound Name | 9-methyl-12-oxatricyclo[7.2.1.01,7]dodec-10-en-4-yn-6-one |
|---|---|
| PubChem CID | 85376016 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 9-methyl-12-oxatricyclo[7.2.1.01,7]dodec-10-en-4-yn-6-one |
| SMILES | CC12C=CC3(CCC#CC(=O)C3C1)O2 |
| InChI | InChI=1S/C12H12O2/c1-11-6-7-12(14-11)5-3-2-4-10(13)9(12)8-11/h6-7,9H,3,5,8H2,1H3 |
| InChIKey | OYZVAMXXGWPFAJ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|