C12H12O3 — CID 98481869
(1S,5S,6R,10S)-13-oxatetracyclo[8.2.1.01,5.06,10]tridec-11-ene-4,7-dione (PubChem CID 98481869) has the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. Its IUPAC name is (1S,5S,6R,10S)-13-oxatetracyclo[8.2.1.01,5.06,10]tridec-11-ene-4,7-dione.
| Compound Name | (1S,5S,6R,10S)-13-oxatetracyclo[8.2.1.01,5.06,10]tridec-11-ene-4,7-dione |
|---|---|
| PubChem CID | 98481869 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | (1S,5S,6R,10S)-13-oxatetracyclo[8.2.1.01,5.06,10]tridec-11-ene-4,7-dione |
| SMILES | O=C1CC[C@]23C=C[C@]4(CCC(=O)[C@H]4[C@@H]12)O3 |
| InChI | InChI=1S/C12H12O3/c13-7-1-3-11-5-6-12(15-11)4-2-8(14)10(12)9(7)11/h5-6,9-10H,1-4H2/t9-,10+,11-,12-/m0/s1 |
| InChIKey | LXEYRUHNCGAFLD-USZNOCQGSA-N |
| XLogP | 1.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|