C18H26O — CID 11065120
(1R,7E,11R,12R)-8,11,12-trimethylbicyclo[9.3.1]pentadec-7-en-3-yn-2-one (PubChem CID 11065120) has the molecular formula C18H26O and a molecular weight of 258.40 g/mol. Its IUPAC name is (1R,7E,11R,12R)-8,11,12-trimethylbicyclo[9.3.1]pentadec-7-en-3-yn-2-one.
| Compound Name | (1R,7E,11R,12R)-8,11,12-trimethylbicyclo[9.3.1]pentadec-7-en-3-yn-2-one |
|---|---|
| PubChem CID | 11065120 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | (1R,7E,11R,12R)-8,11,12-trimethylbicyclo[9.3.1]pentadec-7-en-3-yn-2-one |
| SMILES | C/C1=C\CCC#CC(=O)[C@@H]2CC[C@@H](C)[C@](C)(CC1)C2 |
| InChI | InChI=1S/C18H26O/c1-14-7-5-4-6-8-17(19)16-10-9-15(2)18(3,13-16)12-11-14/h7,15-16H,4-5,9-13H2,1-3H3/b14-7+/t15-,16-,18-/m1/s1 |
| InChIKey | KIOXAASUBPICIS-JPBKCKCMSA-N |
| XLogP | 4.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|