C19H29ClN4O2 — CID 8540438
2-[4-[2-[(4-chlorophenyl)methyl-methylamino]acetyl]piperazin-1-yl]-N-propan-2-ylacetamide (PubChem CID 8540438) has the molecular formula C19H29ClN4O2 and a molecular weight of 380.92 g/mol. Its IUPAC name is 2-[4-[2-[(4-chlorophenyl)methyl-methylamino]acetyl]piperazin-1-yl]-N-propan-2-ylacetamide.
| Compound Name | 2-[4-[2-[(4-chlorophenyl)methyl-methylamino]acetyl]piperazin-1-yl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 8540438 |
| Molecular Formula | C19H29ClN4O2 |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 2-[4-[2-[(4-chlorophenyl)methyl-methylamino]acetyl]piperazin-1-yl]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CN1CCN(C(=O)CN(C)Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H29ClN4O2/c1-15(2)21-18(25)13-23-8-10-24(11-9-23)19(26)14-22(3)12-16-4-6-17(20)7-5-16/h4-7,15H,8-14H2,1-3H3,(H,21,25) |
| InChIKey | GYQCFJPPZLCFFM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |