C18H29N2O3+ — CID 8540592
2-[(3R,5R)-3,5-dimethylpiperidin-1-ium-1-yl]-N-[2-(2-methoxyphenoxy)ethyl]acetamide (PubChem CID 8540592) has the molecular formula C18H29N2O3+ and a molecular weight of 321.44 g/mol. Its IUPAC name is 2-[(3R,5R)-3,5-dimethylpiperidin-1-ium-1-yl]-N-[2-(2-methoxyphenoxy)ethyl]acetamide.
| Compound Name | 2-[(3R,5R)-3,5-dimethylpiperidin-1-ium-1-yl]-N-[2-(2-methoxyphenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 8540592 |
| Molecular Formula | C18H29N2O3+ |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | 2-[(3R,5R)-3,5-dimethylpiperidin-1-ium-1-yl]-N-[2-(2-methoxyphenoxy)ethyl]acetamide |
| SMILES | COc1ccccc1OCCNC(=O)C[NH+]1C[C@H](C)C[C@@H](C)C1 |
| InChI | InChI=1S/C18H28N2O3/c1-14-10-15(2)12-20(11-14)13-18(21)19-8-9-23-17-7-5-4-6-16(17)22-3/h4-7,14-15H,8-13H2,1-3H3,(H,19,21)/p+1/t14-,15-/m1/s1 |
| InChIKey | WXRDZOZOHNOAPY-HUUCEWRRSA-O |
| XLogP | 0.75 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|