C19H25N2O3S+ — CID 9000748
N-[2-(2-methoxyphenoxy)ethyl]-2-[(4S)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetamide (PubChem CID 9000748) has the molecular formula C19H25N2O3S+ and a molecular weight of 361.49 g/mol. Its IUPAC name is N-[2-(2-methoxyphenoxy)ethyl]-2-[(4S)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetamide.
| Compound Name | N-[2-(2-methoxyphenoxy)ethyl]-2-[(4S)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetamide |
|---|---|
| PubChem CID | 9000748 |
| Molecular Formula | C19H25N2O3S+ |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | N-[2-(2-methoxyphenoxy)ethyl]-2-[(4S)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetamide |
| SMILES | COc1ccccc1OCCNC(=O)C[NH+]1CCc2sccc2[C@@H]1C |
| InChI | InChI=1S/C19H24N2O3S/c1-14-15-8-12-25-18(15)7-10-21(14)13-19(22)20-9-11-24-17-6-4-3-5-16(17)23-2/h3-6,8,12,14H,7,9-11,13H2,1-2H3,(H,20,22)/p+1/t14-/m0/s1 |
| InChIKey | RKBLKTIHCAGXLJ-AWEZNQCLSA-O |
| XLogP | 1.45 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|