C16H21NO5 — CID 9230441
cis-[2-[2-(2-methoxyphenoxy)ethylamino]-2-oxoethyl] (1R,2S)-2-methylcyclopropane-1-carboxylate (PubChem CID 9230441) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is cis-[2-[2-(2-methoxyphenoxy)ethylamino]-2-oxoethyl] (1R,2S)-2-methylcyclopropane-1-carboxylate.
| Compound Name | cis-[2-[2-(2-methoxyphenoxy)ethylamino]-2-oxoethyl] (1R,2S)-2-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 9230441 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | cis-[2-[2-(2-methoxyphenoxy)ethylamino]-2-oxoethyl] (1R,2S)-2-methylcyclopropane-1-carboxylate |
| SMILES | COc1ccccc1OCCNC(=O)COC(=O)[C@@H]1C[C@@H]1C |
| InChI | InChI=1S/C16H21NO5/c1-11-9-12(11)16(19)22-10-15(18)17-7-8-21-14-6-4-3-5-13(14)20-2/h3-6,11-12H,7-10H2,1-2H3,(H,17,18)/t11-,12+/m0/s1 |
| InChIKey | QNTSJJPZAOCCRO-NWDGAFQWSA-N |
| XLogP | 1.39 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|