C18H19N5O3S — CID 8541692
[2-oxo-2-(2-propan-2-ylanilino)ethyl] 2-(5-thiophen-2-yltetrazol-2-yl)acetate (PubChem CID 8541692) has the molecular formula C18H19N5O3S and a molecular weight of 385.45 g/mol. Its IUPAC name is [2-oxo-2-(2-propan-2-ylanilino)ethyl] 2-(5-thiophen-2-yltetrazol-2-yl)acetate.
| Compound Name | [2-oxo-2-(2-propan-2-ylanilino)ethyl] 2-(5-thiophen-2-yltetrazol-2-yl)acetate |
|---|---|
| PubChem CID | 8541692 |
| Molecular Formula | C18H19N5O3S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | [2-oxo-2-(2-propan-2-ylanilino)ethyl] 2-(5-thiophen-2-yltetrazol-2-yl)acetate |
| SMILES | CC(C)c1ccccc1NC(=O)COC(=O)Cn1nnc(-c2cccs2)n1 |
| InChI | InChI=1S/C18H19N5O3S/c1-12(2)13-6-3-4-7-14(13)19-16(24)11-26-17(25)10-23-21-18(20-22-23)15-8-5-9-27-15/h3-9,12H,10-11H2,1-2H3,(H,19,24) |
| InChIKey | WKSSIYBVKHZHFV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |