C18H17N5O4S — CID 8542475
[2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 2-(5-thiophen-2-yltetrazol-2-yl)acetate (PubChem CID 8542475) has the molecular formula C18H17N5O4S and a molecular weight of 399.43 g/mol. Its IUPAC name is [2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 2-(5-thiophen-2-yltetrazol-2-yl)acetate.
| Compound Name | [2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 2-(5-thiophen-2-yltetrazol-2-yl)acetate |
|---|---|
| PubChem CID | 8542475 |
| Molecular Formula | C18H17N5O4S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | [2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 2-(5-thiophen-2-yltetrazol-2-yl)acetate |
| SMILES | CCC(=O)Nc1ccc(C(=O)COC(=O)Cn2nnc(-c3cccs3)n2)cc1 |
| InChI | InChI=1S/C18H17N5O4S/c1-2-16(25)19-13-7-5-12(6-8-13)14(24)11-27-17(26)10-23-21-18(20-22-23)15-4-3-9-28-15/h3-9H,2,10-11H2,1H3,(H,19,25) |
| InChIKey | KYBWTDCZYDAALU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |