C16H11ClN6O3S — CID 8541436
[2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 2-(5-thiophen-2-yltetrazol-2-yl)acetate (PubChem CID 8541436) has the molecular formula C16H11ClN6O3S and a molecular weight of 402.82 g/mol. Its IUPAC name is [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 2-(5-thiophen-2-yltetrazol-2-yl)acetate.
| Compound Name | [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 2-(5-thiophen-2-yltetrazol-2-yl)acetate |
|---|---|
| PubChem CID | 8541436 |
| Molecular Formula | C16H11ClN6O3S |
| Molecular Weight | 402.82 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 2-(5-thiophen-2-yltetrazol-2-yl)acetate |
| SMILES | N#Cc1ccc(Cl)cc1NC(=O)COC(=O)Cn1nnc(-c2cccs2)n1 |
| InChI | InChI=1S/C16H11ClN6O3S/c17-11-4-3-10(7-18)12(6-11)19-14(24)9-26-15(25)8-23-21-16(20-22-23)13-2-1-5-27-13/h1-6H,8-9H2,(H,19,24) |
| InChIKey | PQDXOCJPGPXIKT-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 122.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.82 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |