C14H18Cl3N3O3 — CID 85421418
ethyl 2-diazo-3-[(2,2,2-trichloroacetyl)amino]dec-4-ynoate (PubChem CID 85421418) has the molecular formula C14H18Cl3N3O3 and a molecular weight of 382.68 g/mol. Its IUPAC name is ethyl 2-diazo-3-[(2,2,2-trichloroacetyl)amino]dec-4-ynoate.
| Compound Name | ethyl 2-diazo-3-[(2,2,2-trichloroacetyl)amino]dec-4-ynoate |
|---|---|
| PubChem CID | 85421418 |
| Molecular Formula | C14H18Cl3N3O3 |
| Molecular Weight | 382.68 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | ethyl 2-diazo-3-[(2,2,2-trichloroacetyl)amino]dec-4-ynoate |
| SMILES | CCCCCC#CC(NC(=O)C(Cl)(Cl)Cl)C(=[N+]=[N-])C(=O)OCC |
| InChI | InChI=1S/C14H18Cl3N3O3/c1-3-5-6-7-8-9-10(19-13(22)14(15,16)17)11(20-18)12(21)23-4-2/h10H,3-7H2,1-2H3,(H,19,22) |
| InChIKey | SWKTXQNUPFPNKP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.68 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|