C24H40Cl3N3O3 — CID 139249998
ethyl (E)-2-diazo-3-[(2,2,2-trichloroacetyl)amino]icos-11-enoate (PubChem CID 139249998) has the molecular formula C24H40Cl3N3O3 and a molecular weight of 524.96 g/mol. Its IUPAC name is ethyl (E)-2-diazo-3-[(2,2,2-trichloroacetyl)amino]icos-11-enoate.
| Compound Name | ethyl (E)-2-diazo-3-[(2,2,2-trichloroacetyl)amino]icos-11-enoate |
|---|---|
| PubChem CID | 139249998 |
| Molecular Formula | C24H40Cl3N3O3 |
| Molecular Weight | 524.96 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | ethyl (E)-2-diazo-3-[(2,2,2-trichloroacetyl)amino]icos-11-enoate |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(NC(=O)C(Cl)(Cl)Cl)C(=[N+]=[N-])C(=O)OCC |
| InChI | InChI=1S/C24H40Cl3N3O3/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(29-23(32)24(25,26)27)21(30-28)22(31)33-4-2/h11-12,20H,3-10,13-19H2,1-2H3,(H,29,32)/b12-11+ |
| InChIKey | JJTCIZNGFLPEAN-VAWYXSNFSA-N |
| XLogP | 7.11 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.96 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|