C34H32Cl3NO10 — CID 85423217
[5-acetyloxy-2-(9H-fluoren-9-ylmethoxycarbonyloxymethyl)-3-phenylmethoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-4-yl] acetate (PubChem CID 85423217) has the molecular formula C34H32Cl3NO10 and a molecular weight of 720.99 g/mol. Its IUPAC name is [5-acetyloxy-2-(9H-fluoren-9-ylmethoxycarbonyloxymethyl)-3-phenylmethoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-4-yl] acetate.
| Compound Name | [5-acetyloxy-2-(9H-fluoren-9-ylmethoxycarbonyloxymethyl)-3-phenylmethoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-4-yl] acetate |
|---|---|
| PubChem CID | 85423217 |
| Molecular Formula | C34H32Cl3NO10 |
| Molecular Weight | 720.99 g/mol |
| Exact Mass | 719.11 |
| IUPAC Name | [5-acetyloxy-2-(9H-fluoren-9-ylmethoxycarbonyloxymethyl)-3-phenylmethoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-4-yl] acetate |
| SMILES | [H]/N=C(/OC1OC(COC(=O)OCC2c3ccccc3-c3ccccc32)C(OCc2ccccc2)C(OC(C)=O)C1OC(C)=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C34H32Cl3NO10/c1-19(39)45-29-28(42-16-21-10-4-3-5-11-21)27(47-31(30(29)46-20(2)40)48-32(38)34(35,36)37)18-44-33(41)43-17-26-24-14-8-6-12-22(24)23-13-7-9-15-25(23)26/h3-15,26-31,38H,16-18H2,1-2H3/b38-32+ |
| InChIKey | WNRLUDVYXKHJAL-WAQNPYFYSA-N |
| XLogP | 6.49 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.99 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|