C17H16O3 — CID 85435336
5-(2-phenylethenyl)-3a,4,5,6,7,7a-hexahydroindene-1,2,3-trione (PubChem CID 85435336) has the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. Its IUPAC name is 5-(2-phenylethenyl)-3a,4,5,6,7,7a-hexahydroindene-1,2,3-trione.
| Compound Name | 5-(2-phenylethenyl)-3a,4,5,6,7,7a-hexahydroindene-1,2,3-trione |
|---|---|
| PubChem CID | 85435336 |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 5-(2-phenylethenyl)-3a,4,5,6,7,7a-hexahydroindene-1,2,3-trione |
| SMILES | O=C1C(=O)C2CCC(C=Cc3ccccc3)CC2C1=O |
| InChI | InChI=1S/C17H16O3/c18-15-13-9-8-12(10-14(13)16(19)17(15)20)7-6-11-4-2-1-3-5-11/h1-7,12-14H,8-10H2 |
| InChIKey | BVBIPDTWTDDKKW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|