C20H16N2O3 — CID 854460
(4S)-2-amino-4-[(1R,4R)-1-bicyclo[2.2.1]hept-2-enyl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile (PubChem CID 854460) has the molecular formula C20H16N2O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is (4S)-2-amino-4-[(1R,4R)-1-bicyclo[2.2.1]hept-2-enyl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile.
| Compound Name | (4S)-2-amino-4-[(1R,4R)-1-bicyclo[2.2.1]hept-2-enyl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 854460 |
| Molecular Formula | C20H16N2O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | (4S)-2-amino-4-[(1R,4R)-1-bicyclo[2.2.1]hept-2-enyl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile |
| SMILES | N#CC1=C(N)Oc2c(c(=O)oc3ccccc23)[C@H]1[C@]12C=C[C@H](CC1)C2 |
| InChI | InChI=1S/C20H16N2O3/c21-10-13-16(20-7-5-11(9-20)6-8-20)15-17(25-18(13)22)12-3-1-2-4-14(12)24-19(15)23/h1-5,7,11,16H,6,8-9,22H2/t11-,16+,20-/m1/s1 |
| InChIKey | LDIVSFFWSCEOTP-BFKBOQTRSA-N |
| XLogP | 3.32 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|