C18H24N4O4S — CID 85465370
2-[2-[2-(3-methoxyanilino)-2-oxoethyl]sulfanyl-6-oxo-1,3-diazinan-4-yl]-N-prop-2-enylacetamide (PubChem CID 85465370) has the molecular formula C18H24N4O4S and a molecular weight of 392.48 g/mol. Its IUPAC name is 2-[2-[2-(3-methoxyanilino)-2-oxoethyl]sulfanyl-6-oxo-1,3-diazinan-4-yl]-N-prop-2-enylacetamide.
| Compound Name | 2-[2-[2-(3-methoxyanilino)-2-oxoethyl]sulfanyl-6-oxo-1,3-diazinan-4-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 85465370 |
| Molecular Formula | C18H24N4O4S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 2-[2-[2-(3-methoxyanilino)-2-oxoethyl]sulfanyl-6-oxo-1,3-diazinan-4-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CC1CC(=O)NC(SCC(=O)Nc2cccc(OC)c2)N1 |
| InChI | InChI=1S/C18H24N4O4S/c1-3-7-19-15(23)9-13-10-16(24)22-18(21-13)27-11-17(25)20-12-5-4-6-14(8-12)26-2/h3-6,8,13,18,21H,1,7,9-11H2,2H3,(H,19,23)(H,20,25)(H,22,24) |
| InChIKey | WJZQSRNTJXJPLM-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|