C17H27N2O2+ — CID 8548424
4-[3-(4-tert-butylphenoxy)propyl]piperazin-4-ium-2-one (PubChem CID 8548424) has the molecular formula C17H27N2O2+ and a molecular weight of 291.41 g/mol. Its IUPAC name is 4-[3-(4-tert-butylphenoxy)propyl]piperazin-4-ium-2-one.
| Compound Name | 4-[3-(4-tert-butylphenoxy)propyl]piperazin-4-ium-2-one |
|---|---|
| PubChem CID | 8548424 |
| Molecular Formula | C17H27N2O2+ |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | 4-[3-(4-tert-butylphenoxy)propyl]piperazin-4-ium-2-one |
| SMILES | CC(C)(C)c1ccc(OCCC[NH+]2CCNC(=O)C2)cc1 |
| InChI | InChI=1S/C17H26N2O2/c1-17(2,3)14-5-7-15(8-6-14)21-12-4-10-19-11-9-18-16(20)13-19/h5-8H,4,9-13H2,1-3H3,(H,18,20)/p+1 |
| InChIKey | DBRVWMZTUNKTPB-UHFFFAOYSA-O |
| XLogP | 0.77 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|