C17H24N2O2S — CID 175502448
4-[3-(4-tert-butylphenoxy)propylsulfanylmethyl]-1,3-dihydroimidazol-2-one (PubChem CID 175502448) has the molecular formula C17H24N2O2S and a molecular weight of 320.46 g/mol. Its IUPAC name is 4-[3-(4-tert-butylphenoxy)propylsulfanylmethyl]-1,3-dihydroimidazol-2-one.
| Compound Name | 4-[3-(4-tert-butylphenoxy)propylsulfanylmethyl]-1,3-dihydroimidazol-2-one |
|---|---|
| PubChem CID | 175502448 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 4-[3-(4-tert-butylphenoxy)propylsulfanylmethyl]-1,3-dihydroimidazol-2-one |
| SMILES | CC(C)(C)c1ccc(OCCCSCc2c[nH]c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C17H24N2O2S/c1-17(2,3)13-5-7-15(8-6-13)21-9-4-10-22-12-14-11-18-16(20)19-14/h5-8,11H,4,9-10,12H2,1-3H3,(H2,18,19,20) |
| InChIKey | PIEDYYDUWMSLSJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|