C25H26N4O+2 — CID 8548728
1-(2-phenyl-1H-indol-3-yl)-2-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)ethanone (PubChem CID 8548728) has the molecular formula C25H26N4O+2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 1-(2-phenyl-1H-indol-3-yl)-2-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)ethanone.
| Compound Name | 1-(2-phenyl-1H-indol-3-yl)-2-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)ethanone |
|---|---|
| PubChem CID | 8548728 |
| Molecular Formula | C25H26N4O+2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 1-(2-phenyl-1H-indol-3-yl)-2-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)ethanone |
| SMILES | O=C(C[NH+]1CCN(c2cccc[nH+]2)CC1)c1c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C25H24N4O/c30-22(18-28-14-16-29(17-15-28)23-12-6-7-13-26-23)24-20-10-4-5-11-21(20)27-25(24)19-8-2-1-3-9-19/h1-13,27H,14-18H2/p+2 |
| InChIKey | VEEVZGOWPRVDSW-UHFFFAOYSA-P |
| XLogP | 2.24 |
| TPSA | 54.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |