C16H22N3O5+ — CID 8560547
methyl 2-[(2S)-1-[2-(3-methoxyanilino)-2-oxoethyl]-3-oxopiperazin-1-ium-2-yl]acetate (PubChem CID 8560547) has the molecular formula C16H22N3O5+ and a molecular weight of 336.37 g/mol. Its IUPAC name is methyl 2-[(2S)-1-[2-(3-methoxyanilino)-2-oxoethyl]-3-oxopiperazin-1-ium-2-yl]acetate.
| Compound Name | methyl 2-[(2S)-1-[2-(3-methoxyanilino)-2-oxoethyl]-3-oxopiperazin-1-ium-2-yl]acetate |
|---|---|
| PubChem CID | 8560547 |
| Molecular Formula | C16H22N3O5+ |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | methyl 2-[(2S)-1-[2-(3-methoxyanilino)-2-oxoethyl]-3-oxopiperazin-1-ium-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1C(=O)NCC[NH+]1CC(=O)Nc1cccc(OC)c1 |
| InChI | InChI=1S/C16H21N3O5/c1-23-12-5-3-4-11(8-12)18-14(20)10-19-7-6-17-16(22)13(19)9-15(21)24-2/h3-5,8,13H,6-7,9-10H2,1-2H3,(H,17,22)(H,18,20)/p+1/t13-/m0/s1 |
| InChIKey | ZKJCDKNAONTBNL-ZDUSSCGKSA-O |
| XLogP | -1.42 |
| TPSA | 98.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |