C21H24N3O4+ — CID 8562050
methyl 2-[(2S)-3-oxo-1-[2-oxo-2-(2-phenylanilino)ethyl]piperazin-1-ium-2-yl]acetate (PubChem CID 8562050) has the molecular formula C21H24N3O4+ and a molecular weight of 382.44 g/mol. Its IUPAC name is methyl 2-[(2S)-3-oxo-1-[2-oxo-2-(2-phenylanilino)ethyl]piperazin-1-ium-2-yl]acetate.
| Compound Name | methyl 2-[(2S)-3-oxo-1-[2-oxo-2-(2-phenylanilino)ethyl]piperazin-1-ium-2-yl]acetate |
|---|---|
| PubChem CID | 8562050 |
| Molecular Formula | C21H24N3O4+ |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | methyl 2-[(2S)-3-oxo-1-[2-oxo-2-(2-phenylanilino)ethyl]piperazin-1-ium-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1C(=O)NCC[NH+]1CC(=O)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C21H23N3O4/c1-28-20(26)13-18-21(27)22-11-12-24(18)14-19(25)23-17-10-6-5-9-16(17)15-7-3-2-4-8-15/h2-10,18H,11-14H2,1H3,(H,22,27)(H,23,25)/p+1/t18-/m0/s1 |
| InChIKey | ZANHQLKEKKXRMP-SFHVURJKSA-O |
| XLogP | 0.24 |
| TPSA | 88.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |