C18H16N3S+ — CID 8567991
N-(1,3-benzothiazol-2-ylmethyl)-N-methylquinolin-1-ium-2-amine (PubChem CID 8567991) has the molecular formula C18H16N3S+ and a molecular weight of 306.41 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-N-methylquinolin-1-ium-2-amine.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-N-methylquinolin-1-ium-2-amine |
|---|---|
| PubChem CID | 8567991 |
| Molecular Formula | C18H16N3S+ |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-N-methylquinolin-1-ium-2-amine |
| SMILES | CN(Cc1nc2ccccc2s1)c1ccc2ccccc2[nH+]1 |
| InChI | InChI=1S/C18H15N3S/c1-21(12-18-20-15-8-4-5-9-16(15)22-18)17-11-10-13-6-2-3-7-14(13)19-17/h2-11H,12H2,1H3/p+1 |
| InChIKey | FLMLOZAXUKUFQF-UHFFFAOYSA-O |
| XLogP | 3.90 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |