C15H25N3O4 — CID 8568521
[2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 3-(carbamoylamino)propanoate (PubChem CID 8568521) has the molecular formula C15H25N3O4 and a molecular weight of 311.38 g/mol. Its IUPAC name is [2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 3-(carbamoylamino)propanoate.
| Compound Name | [2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 3-(carbamoylamino)propanoate |
|---|---|
| PubChem CID | 8568521 |
| Molecular Formula | C15H25N3O4 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | [2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 3-(carbamoylamino)propanoate |
| SMILES | NC(=O)NCCC(=O)OCC(=O)N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C15H25N3O4/c16-15(21)17-8-7-14(20)22-10-13(19)18-9-3-5-11-4-1-2-6-12(11)18/h11-12H,1-10H2,(H3,16,17,21)/t11-,12-/m1/s1 |
| InChIKey | SFSAAASFHYNYQG-VXGBXAGGSA-N |
| XLogP | 0.77 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |