C24H28N2O4 — CID 8573697
[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 2-(naphthalene-2-carbonylamino)acetate (PubChem CID 8573697) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is [2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 2-(naphthalene-2-carbonylamino)acetate.
| Compound Name | [2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 2-(naphthalene-2-carbonylamino)acetate |
|---|---|
| PubChem CID | 8573697 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | [2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 2-(naphthalene-2-carbonylamino)acetate |
| SMILES | O=C(CNC(=O)c1ccc2ccccc2c1)OCC(=O)N1CCC[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C24H28N2O4/c27-22(26-13-5-9-18-7-3-4-10-21(18)26)16-30-23(28)15-25-24(29)20-12-11-17-6-1-2-8-19(17)14-20/h1-2,6,8,11-12,14,18,21H,3-5,7,9-10,13,15-16H2,(H,25,29)/t18-,21+/m1/s1 |
| InChIKey | RDYYSGKCSKNQEH-NQIIRXRSSA-N |
| XLogP | 3.29 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |