C26H32N2O4 — CID 123749413
[(2-naphthalen-2-ylacetyl)amino] 5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-5-oxopentanoate (PubChem CID 123749413) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is [(2-naphthalen-2-ylacetyl)amino] 5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-5-oxopentanoate.
| Compound Name | [(2-naphthalen-2-ylacetyl)amino] 5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-5-oxopentanoate |
|---|---|
| PubChem CID | 123749413 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | [(2-naphthalen-2-ylacetyl)amino] 5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-5-oxopentanoate |
| SMILES | O=C(Cc1ccc2ccccc2c1)NOC(=O)CCCC(=O)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C26H32N2O4/c29-24(18-19-14-15-20-7-1-2-9-22(20)17-19)27-32-26(31)13-5-12-25(30)28-16-6-10-21-8-3-4-11-23(21)28/h1-2,7,9,14-15,17,21,23H,3-6,8,10-13,16,18H2,(H,27,29) |
| InChIKey | IYSNNYADSPAIDW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|