C20H24BrNO3 — CID 8568581
[2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] (E)-3-(2-bromophenyl)prop-2-enoate (PubChem CID 8568581) has the molecular formula C20H24BrNO3 and a molecular weight of 406.32 g/mol. Its IUPAC name is [2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] (E)-3-(2-bromophenyl)prop-2-enoate.
| Compound Name | [2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] (E)-3-(2-bromophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8568581 |
| Molecular Formula | C20H24BrNO3 |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | [2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] (E)-3-(2-bromophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1Br)OCC(=O)N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C20H24BrNO3/c21-17-9-3-1-6-15(17)11-12-20(24)25-14-19(23)22-13-5-8-16-7-2-4-10-18(16)22/h1,3,6,9,11-12,16,18H,2,4-5,7-8,10,13-14H2/b12-11+/t16-,18-/m1/s1 |
| InChIKey | YAYKRMSQEFBAQI-OFHUKCQUSA-N |
| XLogP | 4.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|