C18H21BrN2O4 — CID 8624885
[2-[(2R)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] (E)-3-(2-bromo-4-methylphenyl)prop-2-enoate (PubChem CID 8624885) has the molecular formula C18H21BrN2O4 and a molecular weight of 409.28 g/mol. Its IUPAC name is [2-[(2R)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] (E)-3-(2-bromo-4-methylphenyl)prop-2-enoate.
| Compound Name | [2-[(2R)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] (E)-3-(2-bromo-4-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8624885 |
| Molecular Formula | C18H21BrN2O4 |
| Molecular Weight | 409.28 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | [2-[(2R)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] (E)-3-(2-bromo-4-methylphenyl)prop-2-enoate |
| SMILES | Cc1ccc(/C=C/C(=O)OCC(=O)N2CCCC[C@@H]2C(N)=O)c(Br)c1 |
| InChI | InChI=1S/C18H21BrN2O4/c1-12-5-6-13(14(19)10-12)7-8-17(23)25-11-16(22)21-9-3-2-4-15(21)18(20)24/h5-8,10,15H,2-4,9,11H2,1H3,(H2,20,24)/b8-7+/t15-/m1/s1 |
| InChIKey | QWJDNMNAVPFZDK-MVGZEHJDSA-N |
| XLogP | 2.18 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|