C6H6N4O7 — CID 8577
azanium 2,4,6-trinitrophenolate (PubChem CID 8577) has the molecular formula C6H6N4O7 and a molecular weight of 246.14 g/mol. Its IUPAC name is azanium 2,4,6-trinitrophenolate.
| Compound Name | azanium 2,4,6-trinitrophenolate |
|---|---|
| PubChem CID | 8577 |
| Molecular Formula | C6H6N4O7 |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | azanium 2,4,6-trinitrophenolate |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c([O-])c([N+](=O)[O-])c1.[NH4+] |
| InChI | InChI=1S/C6H3N3O7.H3N/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;/h1-2,10H;1H3 |
| InChIKey | PADMMUFPGNGRGI-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 188.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|