C22H16F2O3 — CID 8578754
[2-(2,5-difluorophenyl)-2-oxoethyl] 2,2-diphenylacetate (PubChem CID 8578754) has the molecular formula C22H16F2O3 and a molecular weight of 366.36 g/mol. Its IUPAC name is [2-(2,5-difluorophenyl)-2-oxoethyl] 2,2-diphenylacetate.
| Compound Name | [2-(2,5-difluorophenyl)-2-oxoethyl] 2,2-diphenylacetate |
|---|---|
| PubChem CID | 8578754 |
| Molecular Formula | C22H16F2O3 |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | [2-(2,5-difluorophenyl)-2-oxoethyl] 2,2-diphenylacetate |
| SMILES | O=C(COC(=O)C(c1ccccc1)c1ccccc1)c1cc(F)ccc1F |
| InChI | InChI=1S/C22H16F2O3/c23-17-11-12-19(24)18(13-17)20(25)14-27-22(26)21(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-13,21H,14H2 |
| InChIKey | IEGNQWASIHEZHV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |