C20H16ClN3OS2 — CID 8586685
2-[(Z)-1-chloro-2-[4-(dimethylamino)phenyl]ethenyl]-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 8586685) has the molecular formula C20H16ClN3OS2 and a molecular weight of 413.96 g/mol. Its IUPAC name is 2-[(Z)-1-chloro-2-[4-(dimethylamino)phenyl]ethenyl]-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[(Z)-1-chloro-2-[4-(dimethylamino)phenyl]ethenyl]-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 8586685 |
| Molecular Formula | C20H16ClN3OS2 |
| Molecular Weight | 413.96 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | 2-[(Z)-1-chloro-2-[4-(dimethylamino)phenyl]ethenyl]-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | CN(C)c1ccc(/C=C(\Cl)c2nc3scc(-c4cccs4)c3c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C20H16ClN3OS2/c1-24(2)13-7-5-12(6-8-13)10-15(21)18-22-19(25)17-14(11-27-20(17)23-18)16-4-3-9-26-16/h3-11H,1-2H3,(H,22,23,25)/b15-10- |
| InChIKey | ZXQIKAJFNQKIES-GDNBJRDFSA-N |
| XLogP | 5.52 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.96 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|