C17H25N5 — CID 86002691
4-amino-N'-hexyl-5,7-dimethylcinnoline-3-carboximidamide (PubChem CID 86002691) has the molecular formula C17H25N5 and a molecular weight of 299.42 g/mol. Its IUPAC name is 4-amino-N'-hexyl-5,7-dimethylcinnoline-3-carboximidamide.
| Compound Name | 4-amino-N'-hexyl-5,7-dimethylcinnoline-3-carboximidamide |
|---|---|
| PubChem CID | 86002691 |
| Molecular Formula | C17H25N5 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | 4-amino-N'-hexyl-5,7-dimethylcinnoline-3-carboximidamide |
| SMILES | CCCCCC/N=C(\N)c1nnc2cc(C)cc(C)c2c1N |
| InChI | InChI=1S/C17H25N5/c1-4-5-6-7-8-20-17(19)16-15(18)14-12(3)9-11(2)10-13(14)21-22-16/h9-10H,4-8H2,1-3H3,(H2,18,21)(H2,19,20) |
| InChIKey | UQFJXOAIBOICQQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|